886-38-4 Diphenylcyclopropenone
Produkt-Name |
Diphenylcyclopropenone |
Englischer Name |
Diphenylcyclopropenone; Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
Molekulare Formel |
C15H10O |
Molecular Weight |
206.2393 |
InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
CAS Registry Number |
886-38-4 |
EINECS |
212-948-4 |
Molecular Structure |
|
Dichte |
1.232g/cm3 |
Schmelzpunkt |
119-121℃ |
Siedepunkt |
407.2°C at 760 mmHg |
Brechungsindex |
1.668 |
Flammpunkt |
182.7°C |
Dampfdruck |
7.66E-07mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R43:May cause sensitization by skin contact.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|