ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
Ονομασ?α του προ??ντο? |
4-(difluoromethoxy)bromobenzene |
Αγγλικ? ?νομα |
4-(difluoromethoxy)bromobenzene; 1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
MF |
C7H5BrF2O |
Μοριακ? β?ρο? |
223.0148 |
InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
CAS ΟΧΙ |
5905-69-1 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.583g/cm3 |
Σημε?ο βρασμο? |
205.406°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.492 |
Σημε?ο αν?φλεξη? |
92.591°C |
Π?εση ατμ?ν |
0.359mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
Xi:Irritant;
|
Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|