ChemNet > CAS > 192702-01-5 3-Chloro-4-fluorobenzyl bromide
192702-01-5 3-Chloro-4-fluorobenzyl bromide
termék neve |
3-Chloro-4-fluorobenzyl bromide |
Angol név |
3-Chloro-4-fluorobenzyl bromide; alpha-Bromo-3-chloro-4-fluorotoluene; 4-(bromomethyl)-2-chloro-1-fluorobenzene |
MF |
C7H5BrClF |
Molekulat?meg |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
CAS-szám |
192702-01-5 |
Molekuláris szerkezete |
|
S?r?ség |
1.654g/cm3 |
Forráspont |
235°C at 760 mmHg |
T?résmutató |
1.561 |
Gyulladáspont |
95.9°C |
G?znyomás |
0.0784mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|