ChemNet > CAS > 652-29-9 2',3',4',5',6'-Pentafluoroacetophenone
652-29-9 2',3',4',5',6'-Pentafluoroacetophenone
termék neve |
2',3',4',5',6'-Pentafluoroacetophenone |
Angol név |
2',3',4',5',6'-Pentafluoroacetophenone; 2,3,4,5,6-Pentafluoroacetophenone; 1-(pentafluorophenyl)ethanone |
MF |
C8H3F5O |
Molekulat?meg |
210.1008 |
InChI |
InChI=1/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
CAS-szám |
652-29-9 |
EINECS |
211-487-6 |
Molekuláris szerkezete |
|
S?r?ség |
1.479g/cm3 |
Forráspont |
130.5°C at 760 mmHg |
T?résmutató |
1.424 |
Gyulladáspont |
65.6°C |
G?znyomás |
9.68mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|