ChemNet > CAS > 128495-46-5 4-Fluoro-3-methoxybenzaldehyde
128495-46-5 4-Fluoro-3-methoxybenzaldehyde
?? ????? |
4-Fluoro-3-methoxybenzaldehyde |
?? ????? |
4-Fluoro-3-methoxybenzaldehyde; 4-Fluoro-m-anisaldehyde; 3-Methoxy-4-Fluorobenzaldehyde |
????????? ??????? |
C8H7FO2 |
???? ???????? |
154.1384 |
InChI |
InChI=1/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
???? CAS |
128495-46-5 |
???? ???????? |
|
?????? |
1.192g/cm3 |
????? ????? |
61-63℃ |
????? ????? |
246.3°C at 760 mmHg |
???? ????? |
1.525 |
????? ???? |
99.8°C |
??? ???? |
0.0273mmHg at 25°C |
Hazard ?????? |
|
??????? ???? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|