2142-70-3 2-Iodoacetophenone
produktnavn |
2-Iodoacetophenone |
Engelsk navn |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
Molekyl?r Formel |
C8H7IO |
Molekylvekt |
246.045 |
InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
CAS-nummer |
2142-70-3 |
Molecular Structure |
|
Tetthet |
1.72g/cm3 |
Kokepunkt |
268.2°C at 760 mmHg |
Brytningsindeks |
1.603 |
Flammepunktet |
116°C |
Damptrykk |
0.00779mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|