ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
Nazwa produktu: |
2-Chloro-6-fluoroacetophenone |
Angielska nazwa |
2-Chloro-6-fluoroacetophenone;1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
MF |
C8H6ClFO |
Masie cz?steczkowej |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
Nr CAS |
87327-69-3 |
Struktury molekularnej |
|
G?sto?? |
1.258g/cm3 |
Temperatura wrzenia |
191.8°C at 760 mmHg |
Wspó?czynnik za?amania |
1.512 |
Temperatura zap?onu |
69.8°C |
Ci?nienie pary |
0.506mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|