ChemNet > CAS > 30233-64-8 ??? ?????????? ? ??????? ?? ???????? ? 2?3-????? ???????? ?????? ?????????? ? ??? ?????????? ? 2?3-????? ???????? ?????? ???? ? ??? ???????????? ? ????? ?????? ?? 1?2?3-???????????? ? ???????? ???????????. ????? ????????? ????????. ????? ???????? ??? ???????????? ? ????? ?????? ?? ????????. 1?3-????? ???????? ?????? -2-?? ?????????? ?
30233-64-8 ??? ?????????? ? ??????? ?? ???????? ? 2?3-????? ???????? ?????? ?????????? ? ??? ?????????? ? 2?3-????? ???????? ?????? ???? ? ??? ???????????? ? ????? ?????? ?? 1?2?3-???????????? ? ???????? ???????????. ????? ????????? ????????. ????? ???????? ??? ???????????? ? ????? ?????? ?? ????????. 1?3-????? ???????? ?????? -2-?? ?????????? ?
??? ?????? |
??? ?????????? ? ??????? ?? ???????? ? 2?3-????? ???????? ?????? ?????????? ? ??? ?????????? ? 2?3-????? ???????? ?????? ???? ? ??? ???????????? ? ????? ?????? ?? 1?2?3-???????????? ? ???????? ???????????. ????? ????????? ????????. ????? ???????? ??? ???????????? ? ????? ?????? ?? ????????. 1?3-????? ???????? ?????? -2-?? ?????????? ? |
????? ??????????? |
docosanoic acid, monoester with glycerol; 2,3-Dihydroxypropyl docosanoate; Docosanoic acid, 2,3-dihydroxypropyl ester; Docosanoic acid, monoester with 1,2,3-propanetriol; Glyceryl monobehenate; Behenic monoglyceride; Glycerine monobehenate; Docosanoic acid, monoester with glycerol; 1,3-dihydroxypropan-2-yl docosanoate; Glyceryl Behenate |
?????? ???????? |
C25H50O4 |
????? ??????? ??????? |
414.6621 |
InChI |
InChI=1/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-24(22-26)23-27/h24,26-27H,2-23H2,1H3 |
?????????? ???????? ??????? |
30233-64-8 |
???????? ????????? ??? |
250-097-0 |
???? ?????? |
|
????? |
0.942g/cm3 |
???? ??????? |
533.8°C at 760 mmHg |
????? ???????? |
1.469 |
???? ?????? |
164.6°C |
??? ?????? |
1.27E-13mmHg at 25°C |
?????? ??? ??????? ?????? |
|
??? ????????? |
|
???? ????? |
|
|