ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
ürün Ad? |
1,3-Difluoro-5-iodobenzene |
ingilizce ad? |
1,3-Difluoro-5-iodobenzene; 3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
Moleküler Formülü |
C6H3F2I |
Molekül A??rl??? |
239.9893 |
InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
CAS kay?t numaras? |
2265-91-0 |
Moleküler Yap?s? |
|
Yo?unluk |
2.001g/cm3 |
Kaynama noktas? |
173.9°C at 760 mmHg |
K?r?lma indisi |
1.566 |
Alevlenme noktas? |
63.8°C |
Buhar bas?nc? |
1.66mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|