ChemNet > CAS > 56041-57-7 2,3-Dichloroacetophenone
56041-57-7 2,3-Dichloroacetophenone
ürün Ad? |
2,3-Dichloroacetophenone |
ingilizce ad? |
2,3-Dichloroacetophenone; 1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
Moleküler Formülü |
C8H6Cl2O |
Molekül A??rl??? |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
CAS kay?t numaras? |
56041-57-7 |
EINECS |
259-954-3 |
Moleküler Yap?s? |
|
Yo?unluk |
1.304g/cm3 |
Ergime noktas? |
106℃ |
Kaynama noktas? |
247.3°C at 760 mmHg |
K?r?lma indisi |
1.548 |
Alevlenme noktas? |
101.3°C |
Buhar bas?nc? |
0.0258mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|