ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
?? ????? |
2-bromo-4-fluoroacetophenone |
?? ????? |
2-bromo-4-fluoroacetophenone; 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
????????? ??????? |
C8H6BrFO |
???? ???????? |
217.035 |
InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
???? CAS |
1006-39-9 |
EINECS |
222-263-2 |
???? ???????? |
|
?????? |
1.535g/cm3 |
????? ????? |
258.4°C at 760 mmHg |
???? ????? |
1.534 |
????? ???? |
110.1°C |
??? ???? |
0.0138mmHg at 25°C |
Hazard ?????? |
|
??????? ???? |
R36/38:Irritating to eyes and skin.;
|
?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|