ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
???? |
2-bromo-4-fluoroacetophenone |
?? ?? |
2-bromo-4-fluoroacetophenone; 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
??? |
C8H6BrFO |
??? |
217.035 |
InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
cas?? |
1006-39-9 |
EC?? |
222-263-2 |
?? ?? |
|
?? |
1.535g/cm3 |
??? |
258.4°C at 760 mmHg |
?? ?? |
1.534 |
??? |
110.1°C |
??? |
0.0138mmHg at 25°C |
??? ?? |
|
??? ?? |
R36/38:Irritating to eyes and skin.;
|
?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|