ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
produktnavn |
3-Fluoro-4-methylbenzonitrile |
Engelsk navn |
3-Fluoro-4-methylbenzonitrile; 4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
Molekyl?r Formel |
C8H6FN |
Molekylvekt |
135.1383 |
InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS-nummer |
170572-49-3 |
Molecular Structure |
|
Tetthet |
1.117g/cm3 |
Smeltepunkt |
48-50℃ |
Kokepunkt |
215.069°C at 760 mmHg |
Brytningsindeks |
1.508 |
Flammepunktet |
90.3°C |
Damptrykk |
0.151mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|