ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
ürün Ad? |
3-Fluoro-4-methylbenzonitrile |
ingilizce ad? |
3-Fluoro-4-methylbenzonitrile; 4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
Moleküler Formülü |
C8H6FN |
Molekül A??rl??? |
135.1383 |
InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS kay?t numaras? |
170572-49-3 |
Moleküler Yap?s? |
|
Yo?unluk |
1.117g/cm3 |
Ergime noktas? |
48-50℃ |
Kaynama noktas? |
215.069°C at 760 mmHg |
K?r?lma indisi |
1.508 |
Alevlenme noktas? |
90.3°C |
Buhar bas?nc? |
0.151mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|