ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
termék neve |
2-Bromo-4,6-dimethylaniline |
Angol név |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
MF |
C8H10BrN |
Molekulat?meg |
200.0757 |
InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
CAS-szám |
41825-73-4 |
EINECS |
246-337-9 |
Molekuláris szerkezete |
|
S?r?ség |
1.424g/cm3 |
Olvadáspont |
49-79℃ |
Forráspont |
260.9°C at 760 mmHg |
T?résmutató |
1.596 |
Gyulladáspont |
111.6°C |
G?znyomás |
0.0119mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|