ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
Nazwa produktu: |
2-Bromo-4,6-dimethylaniline |
Angielska nazwa |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
MF |
C8H10BrN |
Masie cz?steczkowej |
200.0757 |
InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
Nr CAS |
41825-73-4 |
EINECS |
246-337-9 |
Struktury molekularnej |
|
G?sto?? |
1.424g/cm3 |
Temperatura topnienia |
49-79℃ |
Temperatura wrzenia |
260.9°C at 760 mmHg |
Wspó?czynnik za?amania |
1.596 |
Temperatura zap?onu |
111.6°C |
Ci?nienie pary |
0.0119mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|