ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
???? |
2-Bromo-4,6-dimethylaniline |
?? ?? |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
??? |
C8H10BrN |
??? |
200.0757 |
InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
cas?? |
41825-73-4 |
EC?? |
246-337-9 |
?? ?? |
|
?? |
1.424g/cm3 |
?? ? |
49-79℃ |
??? |
260.9°C at 760 mmHg |
?? ?? |
1.596 |
??? |
111.6°C |
??? |
0.0119mmHg at 25°C |
??? ?? |
|
??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|