455-67-4 3-fluoropropiophenone
termék neve |
3-fluoropropiophenone |
Angol név |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
MF |
C9H9FO |
Molekulat?meg |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
CAS-szám |
455-67-4 |
Molekuláris szerkezete |
|
S?r?ség |
1.074g/cm3 |
Forráspont |
209.8°C at 760 mmHg |
T?résmutató |
1.489 |
Gyulladáspont |
79.8°C |
G?znyomás |
0.199mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|