455-67-4 3-fluoropropiophenone
Nazwa produktu: |
3-fluoropropiophenone |
Angielska nazwa |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
MF |
C9H9FO |
Masie cz?steczkowej |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
Nr CAS |
455-67-4 |
Struktury molekularnej |
|
G?sto?? |
1.074g/cm3 |
Temperatura wrzenia |
209.8°C at 760 mmHg |
Wspó?czynnik za?amania |
1.489 |
Temperatura zap?onu |
79.8°C |
Ci?nienie pary |
0.199mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|