455-67-4 3-fluoropropiophenone
ürün Ad? |
3-fluoropropiophenone |
ingilizce ad? |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
Moleküler Formülü |
C9H9FO |
Molekül A??rl??? |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
CAS kay?t numaras? |
455-67-4 |
Moleküler Yap?s? |
|
Yo?unluk |
1.074g/cm3 |
Kaynama noktas? |
209.8°C at 760 mmHg |
K?r?lma indisi |
1.489 |
Alevlenme noktas? |
79.8°C |
Buhar bas?nc? |
0.199mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|